C14H20O4 — CID 87200807
methyl 3-cyclohexyl-7,8-dioxatricyclo[4.1.1.01,6]octane-3-carboxylate (PubChem CID 87200807) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is methyl 3-cyclohexyl-7,8-dioxatricyclo[4.1.1.01,6]octane-3-carboxylate.
| Compound Name | methyl 3-cyclohexyl-7,8-dioxatricyclo[4.1.1.01,6]octane-3-carboxylate |
|---|---|
| PubChem CID | 87200807 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | methyl 3-cyclohexyl-7,8-dioxatricyclo[4.1.1.01,6]octane-3-carboxylate |
| SMILES | COC(=O)C1(C2CCCCC2)CCC23OC2(C1)O3 |
| InChI | InChI=1S/C14H20O4/c1-16-11(15)12(10-5-3-2-4-6-10)7-8-13-14(9-12,17-13)18-13/h10H,2-9H2,1H3 |
| InChIKey | ZECQYAZZMVGMPF-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 51.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|