C19H23FN3O2+ — CID 8720093
[(S)-(4-ethylphenyl)-(3-fluorophenyl)methyl]-[2-(methylcarbamoylamino)-2-oxoethyl]azanium (PubChem CID 8720093) has the molecular formula C19H23FN3O2+ and a molecular weight of 344.41 g/mol. Its IUPAC name is [(S)-(4-ethylphenyl)-(3-fluorophenyl)methyl]-[2-(methylcarbamoylamino)-2-oxoethyl]azanium.
| Compound Name | [(S)-(4-ethylphenyl)-(3-fluorophenyl)methyl]-[2-(methylcarbamoylamino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 8720093 |
| Molecular Formula | C19H23FN3O2+ |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | [(S)-(4-ethylphenyl)-(3-fluorophenyl)methyl]-[2-(methylcarbamoylamino)-2-oxoethyl]azanium |
| SMILES | CCc1ccc([C@H]([NH2+]CC(=O)NC(=O)NC)c2cccc(F)c2)cc1 |
| InChI | InChI=1S/C19H22FN3O2/c1-3-13-7-9-14(10-8-13)18(15-5-4-6-16(20)11-15)22-12-17(24)23-19(25)21-2/h4-11,18,22H,3,12H2,1-2H3,(H2,21,23,24,25)/p+1/t18-/m0/s1 |
| InChIKey | CJXAFQYBZHENAF-SFHVURJKSA-O |
| XLogP | 1.50 |
| TPSA | 74.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |