C23H45NO — CID 87202751
N,N-dimethyl-2-[(9Z,12Z)-octadeca-9,12-dienoxy]propan-1-amine (PubChem CID 87202751) has the molecular formula C23H45NO and a molecular weight of 351.62 g/mol. Its IUPAC name is N,N-dimethyl-2-[(9Z,12Z)-octadeca-9,12-dienoxy]propan-1-amine.
| Compound Name | N,N-dimethyl-2-[(9Z,12Z)-octadeca-9,12-dienoxy]propan-1-amine |
|---|---|
| PubChem CID | 87202751 |
| Molecular Formula | C23H45NO |
| Molecular Weight | 351.62 g/mol |
| Exact Mass | 351.35 |
| IUPAC Name | N,N-dimethyl-2-[(9Z,12Z)-octadeca-9,12-dienoxy]propan-1-amine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOC(C)CN(C)C |
| InChI | InChI=1S/C23H45NO/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-25-23(2)22-24(3)4/h9-10,12-13,23H,5-8,11,14-22H2,1-4H3/b10-9-,13-12- |
| InChIKey | BVCRFMYWQCIALH-UTJQPWESSA-N |
| XLogP | 6.77 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.62 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|