About dimethyl-[4-(2,2,2-trifluoroacetyl)oxynaphthalen-1-yl]sulfanium
dimethyl-[4-(2,2,2-trifluoroacetyl)oxynaphthalen-1-yl]sulfanium (PubChem CID 87203192) has the molecular formula C14H12F3O2S+
and a molecular weight of 301.31 g/mol. Its IUPAC name is dimethyl-[4-(2,2,2-trifluoroacetyl)oxynaphthalen-1-yl]sulfanium.
Molecular Properties
| Compound Name | dimethyl-[4-(2,2,2-trifluoroacetyl)oxynaphthalen-1-yl]sulfanium |
| PubChem CID | 87203192 |
| Molecular Formula | C14H12F3O2S+ |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | dimethyl-[4-(2,2,2-trifluoroacetyl)oxynaphthalen-1-yl]sulfanium |
| SMILES | C[S+](C)c1ccc(OC(=O)C(F)(F)F)c2ccccc12 |
| InChI | InChI=1S/C14H12F3O2S/c1-20(2)12-8-7-11(19-13(18)14(15,16)17)9-5-3-4-6-10(9)12/h3-8H,1-2H3/q+1 |
| InChIKey | KZYSMZLOVXGYGE-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze dimethyl-[4-(2,2,2-trifluoroacetyl)oxynaphthalen-1-yl]sulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl-[4-(2,2,2-trifluoroacetyl)oxynaphthalen-1-yl]sulfanium?
The IUPAC name of dimethyl-[4-(2,2,2-trifluoroacetyl)oxynaphthalen-1-yl]sulfanium (CID 87203192) is dimethyl-[4-(2,2,2-trifluoroacetyl)oxynaphthalen-1-yl]sulfanium.
What is the SMILES notation for dimethyl-[4-(2,2,2-trifluoroacetyl)oxynaphthalen-1-yl]sulfanium?
The canonical SMILES for dimethyl-[4-(2,2,2-trifluoroacetyl)oxynaphthalen-1-yl]sulfanium is C[S+](C)c1ccc(OC(=O)C(F)(F)F)c2ccccc12.
What is the InChIKey of dimethyl-[4-(2,2,2-trifluoroacetyl)oxynaphthalen-1-yl]sulfanium?
The InChIKey is KZYSMZLOVXGYGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12F3O2S/c1-20(2)12-8-7-11(19-13(18)14(15,16)17)9-5-3-4-6-10(9)12/h3-8H,1-2H3/q+1.
What are the key properties of dimethyl-[4-(2,2,2-trifluoroacetyl)oxynaphthalen-1-yl]sulfanium?
dimethyl-[4-(2,2,2-trifluoroacetyl)oxynaphthalen-1-yl]sulfanium has a molecular weight of 301.31 g/mol, XLogP of 3.54, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl-[4-(2,2,2-trifluoroacetyl)oxynaphthalen-1-yl]sulfanium is sourced from PubChem (CID 87203192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).