About 5-ethoxy-1-methoxyocta-1,5-diene
5-ethoxy-1-methoxyocta-1,5-diene (PubChem CID 87203458) has the molecular formula C11H20O2
and a molecular weight of 184.28 g/mol. Its IUPAC name is 5-ethoxy-1-methoxyocta-1,5-diene.
Molecular Properties
| Compound Name | 5-ethoxy-1-methoxyocta-1,5-diene |
| PubChem CID | 87203458 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | 5-ethoxy-1-methoxyocta-1,5-diene |
| SMILES | CCC=C(CCC=COC)OCC |
| InChI | InChI=1S/C11H20O2/c1-4-8-11(13-5-2)9-6-7-10-12-3/h7-8,10H,4-6,9H2,1-3H3 |
| InChIKey | ITBHMPQXQFUXEF-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 5-ethoxy-1-methoxyocta-1,5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethoxy-1-methoxyocta-1,5-diene?
The IUPAC name of 5-ethoxy-1-methoxyocta-1,5-diene (CID 87203458) is 5-ethoxy-1-methoxyocta-1,5-diene.
What is the SMILES notation for 5-ethoxy-1-methoxyocta-1,5-diene?
The canonical SMILES for 5-ethoxy-1-methoxyocta-1,5-diene is CCC=C(CCC=COC)OCC.
What is the InChIKey of 5-ethoxy-1-methoxyocta-1,5-diene?
The InChIKey is ITBHMPQXQFUXEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O2/c1-4-8-11(13-5-2)9-6-7-10-12-3/h7-8,10H,4-6,9H2,1-3H3.
What are the key properties of 5-ethoxy-1-methoxyocta-1,5-diene?
5-ethoxy-1-methoxyocta-1,5-diene has a molecular weight of 184.28 g/mol, XLogP of 3.26, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethoxy-1-methoxyocta-1,5-diene is sourced from PubChem (CID 87203458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).