C16H23NO8 — CID 87204278
3-nitro-2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(22),18,20-triene (PubChem CID 87204278) has the molecular formula C16H23NO8 and a molecular weight of 357.36 g/mol. Its IUPAC name is 3-nitro-2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(22),18,20-triene.
| Compound Name | 3-nitro-2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(22),18,20-triene |
|---|---|
| PubChem CID | 87204278 |
| Molecular Formula | C16H23NO8 |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 3-nitro-2,5,8,11,14,17-hexaoxabicyclo[16.4.0]docosa-1(22),18,20-triene |
| SMILES | O=[N+]([O-])C1COCCOCCOCCOCCOc2ccccc2O1 |
| InChI | InChI=1S/C16H23NO8/c18-17(19)16-13-23-10-9-21-6-5-20-7-8-22-11-12-24-14-3-1-2-4-15(14)25-16/h1-4,16H,5-13H2 |
| InChIKey | JYVVQXAWIBGQCJ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 98.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|