C18H21ClN2O5S — CID 87204731
ethyl (1R,2R,4R)-4-(4-chloro-2-methylphenyl)sulfonyl-2-(cyanomethylcarbamoyl)cyclopentane-1-carboxylate (PubChem CID 87204731) has the molecular formula C18H21ClN2O5S and a molecular weight of 412.90 g/mol. Its IUPAC name is ethyl (1R,2R,4R)-4-(4-chloro-2-methylphenyl)sulfonyl-2-(cyanomethylcarbamoyl)cyclopentane-1-carboxylate.
| Compound Name | ethyl (1R,2R,4R)-4-(4-chloro-2-methylphenyl)sulfonyl-2-(cyanomethylcarbamoyl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 87204731 |
| Molecular Formula | C18H21ClN2O5S |
| Molecular Weight | 412.90 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | ethyl (1R,2R,4R)-4-(4-chloro-2-methylphenyl)sulfonyl-2-(cyanomethylcarbamoyl)cyclopentane-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C[C@H](S(=O)(=O)c2ccc(Cl)cc2C)C[C@H]1C(=O)NCC#N |
| InChI | InChI=1S/C18H21ClN2O5S/c1-3-26-18(23)15-10-13(9-14(15)17(22)21-7-6-20)27(24,25)16-5-4-12(19)8-11(16)2/h4-5,8,13-15H,3,7,9-10H2,1-2H3,(H,21,22)/t13-,14-,15-/m1/s1 |
| InChIKey | WBNIGDLFPYLFOV-RBSFLKMASA-N |
| XLogP | 2.02 |
| TPSA | 113.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.90 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|