About [N,N'-bis(prop-2-enyl)carbamimidoyl]-tris(prop-2-enyl)azanium
[N,N'-bis(prop-2-enyl)carbamimidoyl]-tris(prop-2-enyl)azanium (PubChem CID 87204776) has the molecular formula C16H26N3+
and a molecular weight of 260.40 g/mol. Its IUPAC name is [N,N'-bis(prop-2-enyl)carbamimidoyl]-tris(prop-2-enyl)azanium.
Molecular Properties
| Compound Name | [N,N'-bis(prop-2-enyl)carbamimidoyl]-tris(prop-2-enyl)azanium |
| PubChem CID | 87204776 |
| Molecular Formula | C16H26N3+ |
| Molecular Weight | 260.40 g/mol |
| Exact Mass | 260.21 |
| IUPAC Name | [N,N'-bis(prop-2-enyl)carbamimidoyl]-tris(prop-2-enyl)azanium |
| SMILES | C=CC/N=C(\NCC=C)[N+](CC=C)(CC=C)CC=C |
| InChI | InChI=1S/C16H26N3/c1-6-11-17-16(18-12-7-2)19(13-8-3,14-9-4)15-10-5/h6-10H,1-5,11-15H2,(H,17,18)/q+1 |
| InChIKey | UGMIXMKGOITPSR-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.40 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [N,N'-bis(prop-2-enyl)carbamimidoyl]-tris(prop-2-enyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [N,N'-bis(prop-2-enyl)carbamimidoyl]-tris(prop-2-enyl)azanium?
The IUPAC name of [N,N'-bis(prop-2-enyl)carbamimidoyl]-tris(prop-2-enyl)azanium (CID 87204776) is [N,N'-bis(prop-2-enyl)carbamimidoyl]-tris(prop-2-enyl)azanium.
What is the SMILES notation for [N,N'-bis(prop-2-enyl)carbamimidoyl]-tris(prop-2-enyl)azanium?
The canonical SMILES for [N,N'-bis(prop-2-enyl)carbamimidoyl]-tris(prop-2-enyl)azanium is C=CC/N=C(\NCC=C)[N+](CC=C)(CC=C)CC=C.
What is the InChIKey of [N,N'-bis(prop-2-enyl)carbamimidoyl]-tris(prop-2-enyl)azanium?
The InChIKey is UGMIXMKGOITPSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N3/c1-6-11-17-16(18-12-7-2)19(13-8-3,14-9-4)15-10-5/h6-10H,1-5,11-15H2,(H,17,18)/q+1.
What are the key properties of [N,N'-bis(prop-2-enyl)carbamimidoyl]-tris(prop-2-enyl)azanium?
[N,N'-bis(prop-2-enyl)carbamimidoyl]-tris(prop-2-enyl)azanium has a molecular weight of 260.40 g/mol, XLogP of 2.68, 10 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [N,N'-bis(prop-2-enyl)carbamimidoyl]-tris(prop-2-enyl)azanium is sourced from PubChem (CID 87204776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).