About 5-ethylimino-2,2-dimethylhexan-3-one
5-ethylimino-2,2-dimethylhexan-3-one (PubChem CID 87204870) has the molecular formula C10H19NO
and a molecular weight of 169.27 g/mol. Its IUPAC name is 5-ethylimino-2,2-dimethylhexan-3-one.
Molecular Properties
| Compound Name | 5-ethylimino-2,2-dimethylhexan-3-one |
| PubChem CID | 87204870 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | 5-ethylimino-2,2-dimethylhexan-3-one |
| SMILES | CC/N=C(\C)CC(=O)C(C)(C)C |
| InChI | InChI=1S/C10H19NO/c1-6-11-8(2)7-9(12)10(3,4)5/h6-7H2,1-5H3/b11-8+ |
| InChIKey | XRBFJVAICRRFAG-DHZHZOJOSA-N |
| XLogP | 2.47 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-ethylimino-2,2-dimethylhexan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethylimino-2,2-dimethylhexan-3-one?
The IUPAC name of 5-ethylimino-2,2-dimethylhexan-3-one (CID 87204870) is 5-ethylimino-2,2-dimethylhexan-3-one.
What is the SMILES notation for 5-ethylimino-2,2-dimethylhexan-3-one?
The canonical SMILES for 5-ethylimino-2,2-dimethylhexan-3-one is CC/N=C(\C)CC(=O)C(C)(C)C.
What is the InChIKey of 5-ethylimino-2,2-dimethylhexan-3-one?
The InChIKey is XRBFJVAICRRFAG-DHZHZOJOSA-N. The full InChI is InChI=1S/C10H19NO/c1-6-11-8(2)7-9(12)10(3,4)5/h6-7H2,1-5H3/b11-8+.
What are the key properties of 5-ethylimino-2,2-dimethylhexan-3-one?
5-ethylimino-2,2-dimethylhexan-3-one has a molecular weight of 169.27 g/mol, XLogP of 2.47, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethylimino-2,2-dimethylhexan-3-one is sourced from PubChem (CID 87204870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).