C12H17F2NO3 — CID 87205285
ethyl (2Z)-4,4-difluoro-3-oxo-2-(piperidin-1-ylmethylidene)butanoate (PubChem CID 87205285) has the molecular formula C12H17F2NO3 and a molecular weight of 261.27 g/mol. Its IUPAC name is ethyl (2Z)-4,4-difluoro-3-oxo-2-(piperidin-1-ylmethylidene)butanoate.
| Compound Name | ethyl (2Z)-4,4-difluoro-3-oxo-2-(piperidin-1-ylmethylidene)butanoate |
|---|---|
| PubChem CID | 87205285 |
| Molecular Formula | C12H17F2NO3 |
| Molecular Weight | 261.27 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | ethyl (2Z)-4,4-difluoro-3-oxo-2-(piperidin-1-ylmethylidene)butanoate |
| SMILES | CCOC(=O)/C(=C\N1CCCCC1)C(=O)C(F)F |
| InChI | InChI=1S/C12H17F2NO3/c1-2-18-12(17)9(10(16)11(13)14)8-15-6-4-3-5-7-15/h8,11H,2-7H2,1H3/b9-8- |
| InChIKey | BNRAQZQNLDULNL-HJWRWDBZSA-N |
| XLogP | 1.75 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.27 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|