About 5-ethyl-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione
5-ethyl-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione (PubChem CID 87205343) has the molecular formula C9H11NS3
and a molecular weight of 229.39 g/mol. Its IUPAC name is 5-ethyl-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione.
Molecular Properties
| Compound Name | 5-ethyl-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione |
| PubChem CID | 87205343 |
| Molecular Formula | C9H11NS3 |
| Molecular Weight | 229.39 g/mol |
| Exact Mass | 229.01 |
| IUPAC Name | 5-ethyl-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione |
| SMILES | CCN1C(=S)C=C2SCCC2C1=S |
| InChI | InChI=1S/C9H11NS3/c1-2-10-8(11)5-7-6(9(10)12)3-4-13-7/h5-6H,2-4H2,1H3 |
| InChIKey | GTXQJTAVLSSEPG-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.39 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-ethyl-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione?
The IUPAC name of 5-ethyl-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione (CID 87205343) is 5-ethyl-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione.
What is the SMILES notation for 5-ethyl-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione?
The canonical SMILES for 5-ethyl-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione is CCN1C(=S)C=C2SCCC2C1=S.
What is the InChIKey of 5-ethyl-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione?
The InChIKey is GTXQJTAVLSSEPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NS3/c1-2-10-8(11)5-7-6(9(10)12)3-4-13-7/h5-6H,2-4H2,1H3.
What are the key properties of 5-ethyl-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione?
5-ethyl-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione has a molecular weight of 229.39 g/mol, XLogP of 2.61, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione is sourced from PubChem (CID 87205343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).