About (4-sulfonylcyclohexa-1,5-dien-1-yl)methanamine;hydrochloride
(4-sulfonylcyclohexa-1,5-dien-1-yl)methanamine;hydrochloride (PubChem CID 87205345) has the molecular formula C7H10ClNO2S
and a molecular weight of 207.68 g/mol. Its IUPAC name is (4-sulfonylcyclohexa-1,5-dien-1-yl)methanamine;hydrochloride.
Molecular Properties
| Compound Name | (4-sulfonylcyclohexa-1,5-dien-1-yl)methanamine;hydrochloride |
| PubChem CID | 87205345 |
| Molecular Formula | C7H10ClNO2S |
| Molecular Weight | 207.68 g/mol |
| Exact Mass | 207.01 |
| IUPAC Name | (4-sulfonylcyclohexa-1,5-dien-1-yl)methanamine;hydrochloride |
| SMILES | Cl.NCC1=CCC(=S(=O)=O)C=C1 |
| InChI | InChI=1S/C7H9NO2S.ClH/c8-5-6-1-3-7(4-2-6)11(9)10;/h1-3H,4-5,8H2;1H |
| InChIKey | WRULOXZLPRVYDV-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.68 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (4-sulfonylcyclohexa-1,5-dien-1-yl)methanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-sulfonylcyclohexa-1,5-dien-1-yl)methanamine;hydrochloride?
The IUPAC name of (4-sulfonylcyclohexa-1,5-dien-1-yl)methanamine;hydrochloride (CID 87205345) is (4-sulfonylcyclohexa-1,5-dien-1-yl)methanamine;hydrochloride.
What is the SMILES notation for (4-sulfonylcyclohexa-1,5-dien-1-yl)methanamine;hydrochloride?
The canonical SMILES for (4-sulfonylcyclohexa-1,5-dien-1-yl)methanamine;hydrochloride is Cl.NCC1=CCC(=S(=O)=O)C=C1.
What is the InChIKey of (4-sulfonylcyclohexa-1,5-dien-1-yl)methanamine;hydrochloride?
The InChIKey is WRULOXZLPRVYDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO2S.ClH/c8-5-6-1-3-7(4-2-6)11(9)10;/h1-3H,4-5,8H2;1H.
What are the key properties of (4-sulfonylcyclohexa-1,5-dien-1-yl)methanamine;hydrochloride?
(4-sulfonylcyclohexa-1,5-dien-1-yl)methanamine;hydrochloride has a molecular weight of 207.68 g/mol, XLogP of 0.30, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-sulfonylcyclohexa-1,5-dien-1-yl)methanamine;hydrochloride is sourced from PubChem (CID 87205345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).