C11H15NO5 — CID 87205380
6-ethynyl-3,3-dimethoxy-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrole-4-carboxylic acid (PubChem CID 87205380) has the molecular formula C11H15NO5 and a molecular weight of 241.24 g/mol. Its IUPAC name is 6-ethynyl-3,3-dimethoxy-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrole-4-carboxylic acid.
| Compound Name | 6-ethynyl-3,3-dimethoxy-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrole-4-carboxylic acid |
|---|---|
| PubChem CID | 87205380 |
| Molecular Formula | C11H15NO5 |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 6-ethynyl-3,3-dimethoxy-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrole-4-carboxylic acid |
| SMILES | C#CC1CN(C(=O)O)C2C1OCC2(OC)OC |
| InChI | InChI=1S/C11H15NO5/c1-4-7-5-12(10(13)14)9-8(7)17-6-11(9,15-2)16-3/h1,7-9H,5-6H2,2-3H3,(H,13,14) |
| InChIKey | NARGWQVEOAVNDO-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|