About (3-hydroxy-1-adamantyl) 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate
(3-hydroxy-1-adamantyl) 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate (PubChem CID 87205462) has the molecular formula C30H30F2O6S2
and a molecular weight of 588.69 g/mol. Its IUPAC name is (3-hydroxy-1-adamantyl) 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate.
Molecular Properties
| Compound Name | (3-hydroxy-1-adamantyl) 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate |
| PubChem CID | 87205462 |
| Molecular Formula | C30H30F2O6S2 |
| Molecular Weight | 588.69 g/mol |
| Exact Mass | 588.15 |
| IUPAC Name | (3-hydroxy-1-adamantyl) 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate |
| SMILES | O=C(OC12CC3CC(CC(O)(C3)C1)C2)C(F)(F)S(=O)(=O)OS(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H30F2O6S2/c31-30(32,27(33)37-29-19-22-16-23(20-29)18-28(34,17-22)21-29)40(35,36)38-39(24-10-4-1-5-11-24,25-12-6-2-7-13-25)26-14-8-3-9-15-26/h1-15,22-23,34H,16-21H2 |
| InChIKey | HEDXSAZVEQSONA-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 588.69 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (3-hydroxy-1-adamantyl) 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-hydroxy-1-adamantyl) 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate?
The IUPAC name of (3-hydroxy-1-adamantyl) 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate (CID 87205462) is (3-hydroxy-1-adamantyl) 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate.
What is the SMILES notation for (3-hydroxy-1-adamantyl) 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate?
The canonical SMILES for (3-hydroxy-1-adamantyl) 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate is O=C(OC12CC3CC(CC(O)(C3)C1)C2)C(F)(F)S(=O)(=O)OS(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of (3-hydroxy-1-adamantyl) 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate?
The InChIKey is HEDXSAZVEQSONA-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H30F2O6S2/c31-30(32,27(33)37-29-19-22-16-23(20-29)18-28(34,17-22)21-29)40(35,36)38-39(24-10-4-1-5-11-24,25-12-6-2-7-13-25)26-14-8-3-9-15-26/h1-15,22-23,34H,16-21H2.
What are the key properties of (3-hydroxy-1-adamantyl) 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate?
(3-hydroxy-1-adamantyl) 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate has a molecular weight of 588.69 g/mol, XLogP of 6.45, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-hydroxy-1-adamantyl) 2,2-difluoro-2-(triphenyl-λ4-sulfanyl)oxysulfonylacetate is sourced from PubChem (CID 87205462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).