C32H58N2O10 — CID 87206089
2-ethyl-3,4,10-trihydroxy-11-[3-hydroxy-6-methyl-4-[methyl(oxiran-2-ylmethyl)amino]oxan-2-yl]oxy-3,5,6,8,10,12,14-heptamethyl-1-oxa-6-azacyclopentadecane-13,15-dione (PubChem CID 87206089) has the molecular formula C32H58N2O10 and a molecular weight of 630.82 g/mol. Its IUPAC name is 2-ethyl-3,4,10-trihydroxy-11-[3-hydroxy-6-methyl-4-[methyl(oxiran-2-ylmethyl)amino]oxan-2-yl]oxy-3,5,6,8,10,12,14-heptamethyl-1-oxa-6-azacyclopentadecane-13,15-dione.
| Compound Name | 2-ethyl-3,4,10-trihydroxy-11-[3-hydroxy-6-methyl-4-[methyl(oxiran-2-ylmethyl)amino]oxan-2-yl]oxy-3,5,6,8,10,12,14-heptamethyl-1-oxa-6-azacyclopentadecane-13,15-dione |
|---|---|
| PubChem CID | 87206089 |
| Molecular Formula | C32H58N2O10 |
| Molecular Weight | 630.82 g/mol |
| Exact Mass | 630.41 |
| IUPAC Name | 2-ethyl-3,4,10-trihydroxy-11-[3-hydroxy-6-methyl-4-[methyl(oxiran-2-ylmethyl)amino]oxan-2-yl]oxy-3,5,6,8,10,12,14-heptamethyl-1-oxa-6-azacyclopentadecane-13,15-dione |
| SMILES | CCC1OC(=O)C(C)C(=O)C(C)C(OC2OC(C)CC(N(C)CC3CO3)C2O)C(C)(O)CC(C)CN(C)C(C)C(O)C1(C)O |
| InChI | InChI=1S/C32H58N2O10/c1-11-24-32(8,40)27(37)21(6)33(9)14-17(2)13-31(7,39)28(19(4)25(35)20(5)29(38)43-24)44-30-26(36)23(12-18(3)42-30)34(10)15-22-16-41-22/h17-24,26-28,30,36-37,39-40H,11-16H2,1-10H3 |
| InChIKey | WKHLWTRYQDQLET-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 161.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.82 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|