C30H29FN5O7+ — CID 87206143
1-[3-amino-1-(4-fluorophenyl)-2,3-dioxopropyl]-5-oxo-1-(2-oxo-2-piperidin-1-ylethyl)-6-phenylmethoxyimidazo[1,2-a]pyrimidin-1-ium-7-carboxylic acid (PubChem CID 87206143) has the molecular formula C30H29FN5O7+ and a molecular weight of 590.59 g/mol. Its IUPAC name is 1-[3-amino-1-(4-fluorophenyl)-2,3-dioxopropyl]-5-oxo-1-(2-oxo-2-piperidin-1-ylethyl)-6-phenylmethoxyimidazo[1,2-a]pyrimidin-1-ium-7-carboxylic acid.
| Compound Name | 1-[3-amino-1-(4-fluorophenyl)-2,3-dioxopropyl]-5-oxo-1-(2-oxo-2-piperidin-1-ylethyl)-6-phenylmethoxyimidazo[1,2-a]pyrimidin-1-ium-7-carboxylic acid |
|---|---|
| PubChem CID | 87206143 |
| Molecular Formula | C30H29FN5O7+ |
| Molecular Weight | 590.59 g/mol |
| Exact Mass | 590.20 |
| IUPAC Name | 1-[3-amino-1-(4-fluorophenyl)-2,3-dioxopropyl]-5-oxo-1-(2-oxo-2-piperidin-1-ylethyl)-6-phenylmethoxyimidazo[1,2-a]pyrimidin-1-ium-7-carboxylic acid |
| SMILES | NC(=O)C(=O)C(c1ccc(F)cc1)[N+]1(CC(=O)N2CCCCC2)C=Cn2c1nc(C(=O)O)c(OCc1ccccc1)c2=O |
| InChI | InChI=1S/C30H28FN5O7/c31-21-11-9-20(10-12-21)24(25(38)27(32)39)36(17-22(37)34-13-5-2-6-14-34)16-15-35-28(40)26(23(29(41)42)33-30(35)36)43-18-19-7-3-1-4-8-19/h1,3-4,7-12,15-16,24H,2,5-6,13-14,17-18H2,(H2-,32,39,41,42)/p+1 |
| InChIKey | BUARMUGLKJLSEU-UHFFFAOYSA-O |
| XLogP | 2.22 |
| TPSA | 161.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.59 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|