About dimethyl 2-[dimethyl(2,4,4-trimethylpentan-2-yl)silyl]oxypentanedioate
dimethyl 2-[dimethyl(2,4,4-trimethylpentan-2-yl)silyl]oxypentanedioate (PubChem CID 87206560) has the molecular formula C17H34O5Si
and a molecular weight of 346.54 g/mol. Its IUPAC name is dimethyl 2-[dimethyl(2,4,4-trimethylpentan-2-yl)silyl]oxypentanedioate.
Molecular Properties
| Compound Name | dimethyl 2-[dimethyl(2,4,4-trimethylpentan-2-yl)silyl]oxypentanedioate |
| PubChem CID | 87206560 |
| Molecular Formula | C17H34O5Si |
| Molecular Weight | 346.54 g/mol |
| Exact Mass | 346.22 |
| IUPAC Name | dimethyl 2-[dimethyl(2,4,4-trimethylpentan-2-yl)silyl]oxypentanedioate |
| SMILES | COC(=O)CCC(O[Si](C)(C)C(C)(C)CC(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C17H34O5Si/c1-16(2,3)12-17(4,5)23(8,9)22-13(15(19)21-7)10-11-14(18)20-6/h13H,10-12H2,1-9H3 |
| InChIKey | PUPUMMBVSCCWOS-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.54 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 2-[dimethyl(2,4,4-trimethylpentan-2-yl)silyl]oxypentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 2-[dimethyl(2,4,4-trimethylpentan-2-yl)silyl]oxypentanedioate?
The IUPAC name of dimethyl 2-[dimethyl(2,4,4-trimethylpentan-2-yl)silyl]oxypentanedioate (CID 87206560) is dimethyl 2-[dimethyl(2,4,4-trimethylpentan-2-yl)silyl]oxypentanedioate.
What is the SMILES notation for dimethyl 2-[dimethyl(2,4,4-trimethylpentan-2-yl)silyl]oxypentanedioate?
The canonical SMILES for dimethyl 2-[dimethyl(2,4,4-trimethylpentan-2-yl)silyl]oxypentanedioate is COC(=O)CCC(O[Si](C)(C)C(C)(C)CC(C)(C)C)C(=O)OC.
What is the InChIKey of dimethyl 2-[dimethyl(2,4,4-trimethylpentan-2-yl)silyl]oxypentanedioate?
The InChIKey is PUPUMMBVSCCWOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34O5Si/c1-16(2,3)12-17(4,5)23(8,9)22-13(15(19)21-7)10-11-14(18)20-6/h13H,10-12H2,1-9H3.
What are the key properties of dimethyl 2-[dimethyl(2,4,4-trimethylpentan-2-yl)silyl]oxypentanedioate?
dimethyl 2-[dimethyl(2,4,4-trimethylpentan-2-yl)silyl]oxypentanedioate has a molecular weight of 346.54 g/mol, XLogP of 3.92, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2-[dimethyl(2,4,4-trimethylpentan-2-yl)silyl]oxypentanedioate is sourced from PubChem (CID 87206560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).