About 5-O-tert-butyl 1-O-methyl (3R)-3-[tert-butyl(dimethyl)silyl]oxypentanedioate
5-O-tert-butyl 1-O-methyl (3R)-3-[tert-butyl(dimethyl)silyl]oxypentanedioate (PubChem CID 87206661) has the molecular formula C16H32O5Si
and a molecular weight of 332.51 g/mol. Its IUPAC name is 5-O-tert-butyl 1-O-methyl (3R)-3-[tert-butyl(dimethyl)silyl]oxypentanedioate.
Molecular Properties
| Compound Name | 5-O-tert-butyl 1-O-methyl (3R)-3-[tert-butyl(dimethyl)silyl]oxypentanedioate |
| PubChem CID | 87206661 |
| Molecular Formula | C16H32O5Si |
| Molecular Weight | 332.51 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | 5-O-tert-butyl 1-O-methyl (3R)-3-[tert-butyl(dimethyl)silyl]oxypentanedioate |
| SMILES | COC(=O)C[C@H](CC(=O)OC(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H32O5Si/c1-15(2,3)20-14(18)11-12(10-13(17)19-7)21-22(8,9)16(4,5)6/h12H,10-11H2,1-9H3/t12-/m1/s1 |
| InChIKey | YXZRSPKQEBXFRW-GFCCVEGCSA-N |
| XLogP | 3.67 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.51 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 5-O-tert-butyl 1-O-methyl (3R)-3-[tert-butyl(dimethyl)silyl]oxypentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-O-tert-butyl 1-O-methyl (3R)-3-[tert-butyl(dimethyl)silyl]oxypentanedioate?
The IUPAC name of 5-O-tert-butyl 1-O-methyl (3R)-3-[tert-butyl(dimethyl)silyl]oxypentanedioate (CID 87206661) is 5-O-tert-butyl 1-O-methyl (3R)-3-[tert-butyl(dimethyl)silyl]oxypentanedioate.
What is the SMILES notation for 5-O-tert-butyl 1-O-methyl (3R)-3-[tert-butyl(dimethyl)silyl]oxypentanedioate?
The canonical SMILES for 5-O-tert-butyl 1-O-methyl (3R)-3-[tert-butyl(dimethyl)silyl]oxypentanedioate is COC(=O)C[C@H](CC(=O)OC(C)(C)C)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of 5-O-tert-butyl 1-O-methyl (3R)-3-[tert-butyl(dimethyl)silyl]oxypentanedioate?
The InChIKey is YXZRSPKQEBXFRW-GFCCVEGCSA-N. The full InChI is InChI=1S/C16H32O5Si/c1-15(2,3)20-14(18)11-12(10-13(17)19-7)21-22(8,9)16(4,5)6/h12H,10-11H2,1-9H3/t12-/m1/s1.
What are the key properties of 5-O-tert-butyl 1-O-methyl (3R)-3-[tert-butyl(dimethyl)silyl]oxypentanedioate?
5-O-tert-butyl 1-O-methyl (3R)-3-[tert-butyl(dimethyl)silyl]oxypentanedioate has a molecular weight of 332.51 g/mol, XLogP of 3.67, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-O-tert-butyl 1-O-methyl (3R)-3-[tert-butyl(dimethyl)silyl]oxypentanedioate is sourced from PubChem (CID 87206661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).