C12Cl10Te2 — CID 87206865
1,2,3,4,5-pentachloro-6-[(2,3,4,5,6-pentachlorophenyl)ditellanyl]benzene (PubChem CID 87206865) has the molecular formula C12Cl10Te2 and a molecular weight of 753.86 g/mol. Its IUPAC name is 1,2,3,4,5-pentachloro-6-[(2,3,4,5,6-pentachlorophenyl)ditellanyl]benzene.
| Compound Name | 1,2,3,4,5-pentachloro-6-[(2,3,4,5,6-pentachlorophenyl)ditellanyl]benzene |
|---|---|
| PubChem CID | 87206865 |
| Molecular Formula | C12Cl10Te2 |
| Molecular Weight | 753.86 g/mol |
| Exact Mass | 753.50 |
| IUPAC Name | 1,2,3,4,5-pentachloro-6-[(2,3,4,5,6-pentachlorophenyl)ditellanyl]benzene |
| SMILES | Clc1c(Cl)c(Cl)c([Te][Te]c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C12Cl10Te2/c13-1-3(15)7(19)11(8(20)4(1)16)23-24-12-9(21)5(17)2(14)6(18)10(12)22 |
| InChIKey | HCAZTJVMKNXTQJ-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.86 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|