About [4,5-ditert-butyl-2,3-bis(2-tert-butylphenyl)phenyl] dihydrogen phosphite
[4,5-ditert-butyl-2,3-bis(2-tert-butylphenyl)phenyl] dihydrogen phosphite (PubChem CID 87207015) has the molecular formula C34H47O3P
and a molecular weight of 534.72 g/mol. Its IUPAC name is [4,5-ditert-butyl-2,3-bis(2-tert-butylphenyl)phenyl] dihydrogen phosphite.
Molecular Properties
| Compound Name | [4,5-ditert-butyl-2,3-bis(2-tert-butylphenyl)phenyl] dihydrogen phosphite |
| PubChem CID | 87207015 |
| Molecular Formula | C34H47O3P |
| Molecular Weight | 534.72 g/mol |
| Exact Mass | 534.33 |
| IUPAC Name | [4,5-ditert-butyl-2,3-bis(2-tert-butylphenyl)phenyl] dihydrogen phosphite |
| SMILES | CC(C)(C)c1ccccc1-c1c(OP(O)O)cc(C(C)(C)C)c(C(C)(C)C)c1-c1ccccc1C(C)(C)C |
| InChI | InChI=1S/C34H47O3P/c1-31(2,3)24-19-15-13-17-22(24)28-27(37-38(35)36)21-26(33(7,8)9)30(34(10,11)12)29(28)23-18-14-16-20-25(23)32(4,5)6/h13-21,35-36H,1-12H3 |
| InChIKey | OWOAVKTYFKJTSD-UHFFFAOYSA-N |
| XLogP | 9.80 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 534.72 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [4,5-ditert-butyl-2,3-bis(2-tert-butylphenyl)phenyl] dihydrogen phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4,5-ditert-butyl-2,3-bis(2-tert-butylphenyl)phenyl] dihydrogen phosphite?
The IUPAC name of [4,5-ditert-butyl-2,3-bis(2-tert-butylphenyl)phenyl] dihydrogen phosphite (CID 87207015) is [4,5-ditert-butyl-2,3-bis(2-tert-butylphenyl)phenyl] dihydrogen phosphite.
What is the SMILES notation for [4,5-ditert-butyl-2,3-bis(2-tert-butylphenyl)phenyl] dihydrogen phosphite?
The canonical SMILES for [4,5-ditert-butyl-2,3-bis(2-tert-butylphenyl)phenyl] dihydrogen phosphite is CC(C)(C)c1ccccc1-c1c(OP(O)O)cc(C(C)(C)C)c(C(C)(C)C)c1-c1ccccc1C(C)(C)C.
What is the InChIKey of [4,5-ditert-butyl-2,3-bis(2-tert-butylphenyl)phenyl] dihydrogen phosphite?
The InChIKey is OWOAVKTYFKJTSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H47O3P/c1-31(2,3)24-19-15-13-17-22(24)28-27(37-38(35)36)21-26(33(7,8)9)30(34(10,11)12)29(28)23-18-14-16-20-25(23)32(4,5)6/h13-21,35-36H,1-12H3.
What are the key properties of [4,5-ditert-butyl-2,3-bis(2-tert-butylphenyl)phenyl] dihydrogen phosphite?
[4,5-ditert-butyl-2,3-bis(2-tert-butylphenyl)phenyl] dihydrogen phosphite has a molecular weight of 534.72 g/mol, XLogP of 9.80, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4,5-ditert-butyl-2,3-bis(2-tert-butylphenyl)phenyl] dihydrogen phosphite is sourced from PubChem (CID 87207015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).