C24H26ClN7O2 — CID 87207068
N-chloro-N-methyl-3-(methylamino)-4-[4-[(7-oxo-6,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,10,12-pentaen-11-yl)methyl]piperazin-1-yl]benzamide (PubChem CID 87207068) has the molecular formula C24H26ClN7O2 and a molecular weight of 479.97 g/mol. Its IUPAC name is N-chloro-N-methyl-3-(methylamino)-4-[4-[(7-oxo-6,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,10,12-pentaen-11-yl)methyl]piperazin-1-yl]benzamide.
| Compound Name | N-chloro-N-methyl-3-(methylamino)-4-[4-[(7-oxo-6,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,10,12-pentaen-11-yl)methyl]piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 87207068 |
| Molecular Formula | C24H26ClN7O2 |
| Molecular Weight | 479.97 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | N-chloro-N-methyl-3-(methylamino)-4-[4-[(7-oxo-6,8,13-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,10,12-pentaen-11-yl)methyl]piperazin-1-yl]benzamide |
| SMILES | CNc1cc(C(=O)N(C)Cl)ccc1N1CCN(Cc2cnc3c(c2)[nH]c(=O)n2cccc32)CC1 |
| InChI | InChI=1S/C24H26ClN7O2/c1-26-18-13-17(23(33)29(2)25)5-6-20(18)31-10-8-30(9-11-31)15-16-12-19-22(27-14-16)21-4-3-7-32(21)24(34)28-19/h3-7,12-14,26H,8-11,15H2,1-2H3,(H,28,34) |
| InChIKey | YHEAOWFDXPFOAE-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 88.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.97 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|