C19H21ClN2O3S — CID 87207380
(5R)-5-[[4-[2-(3-ethyl-2-pyridinyl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione;hydrochloride (PubChem CID 87207380) has the molecular formula C19H21ClN2O3S and a molecular weight of 392.91 g/mol. Its IUPAC name is (5R)-5-[[4-[2-(3-ethyl-2-pyridinyl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione;hydrochloride.
| Compound Name | (5R)-5-[[4-[2-(3-ethyl-2-pyridinyl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 87207380 |
| Molecular Formula | C19H21ClN2O3S |
| Molecular Weight | 392.91 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | (5R)-5-[[4-[2-(3-ethyl-2-pyridinyl)ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione;hydrochloride |
| SMILES | CCc1cccnc1CCOc1ccc(C[C@H]2SC(=O)NC2=O)cc1.Cl |
| InChI | InChI=1S/C19H20N2O3S.ClH/c1-2-14-4-3-10-20-16(14)9-11-24-15-7-5-13(6-8-15)12-17-18(22)21-19(23)25-17;/h3-8,10,17H,2,9,11-12H2,1H3,(H,21,22,23);1H/t17-;/m1./s1 |
| InChIKey | BOHRTMQXCLLBAQ-UNTBIKODSA-N |
| XLogP | 3.58 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.91 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|