About 2H-1,3-thiazole-3-carbothioic S-acid
2H-1,3-thiazole-3-carbothioic S-acid (PubChem CID 87207423) has the molecular formula C4H5NOS2
and a molecular weight of 147.22 g/mol. Its IUPAC name is 2H-1,3-thiazole-3-carbothioic S-acid.
Molecular Properties
| Compound Name | 2H-1,3-thiazole-3-carbothioic S-acid |
| PubChem CID | 87207423 |
| Molecular Formula | C4H5NOS2 |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 146.98 |
| IUPAC Name | 2H-1,3-thiazole-3-carbothioic S-acid |
| SMILES | O=C(S)N1C=CSC1 |
| InChI | InChI=1S/C4H5NOS2/c6-4(7)5-1-2-8-3-5/h1-2H,3H2,(H,6,7) |
| InChIKey | XAIDPGYOENEKNU-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2H-1,3-thiazole-3-carbothioic S-acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-1,3-thiazole-3-carbothioic S-acid?
The IUPAC name of 2H-1,3-thiazole-3-carbothioic S-acid (CID 87207423) is 2H-1,3-thiazole-3-carbothioic S-acid.
What is the SMILES notation for 2H-1,3-thiazole-3-carbothioic S-acid?
The canonical SMILES for 2H-1,3-thiazole-3-carbothioic S-acid is O=C(S)N1C=CSC1.
What is the InChIKey of 2H-1,3-thiazole-3-carbothioic S-acid?
The InChIKey is XAIDPGYOENEKNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NOS2/c6-4(7)5-1-2-8-3-5/h1-2H,3H2,(H,6,7).
What are the key properties of 2H-1,3-thiazole-3-carbothioic S-acid?
2H-1,3-thiazole-3-carbothioic S-acid has a molecular weight of 147.22 g/mol, XLogP of 1.51, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-1,3-thiazole-3-carbothioic S-acid is sourced from PubChem (CID 87207423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).