C17H18F3N3O3S — CID 87207543
5-[methylsulfonyl(oxiran-2-yl)methyl]-3-[4-(trifluoromethyl)phenyl]-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine (PubChem CID 87207543) has the molecular formula C17H18F3N3O3S and a molecular weight of 401.41 g/mol. Its IUPAC name is 5-[methylsulfonyl(oxiran-2-yl)methyl]-3-[4-(trifluoromethyl)phenyl]-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine.
| Compound Name | 5-[methylsulfonyl(oxiran-2-yl)methyl]-3-[4-(trifluoromethyl)phenyl]-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine |
|---|---|
| PubChem CID | 87207543 |
| Molecular Formula | C17H18F3N3O3S |
| Molecular Weight | 401.41 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | 5-[methylsulfonyl(oxiran-2-yl)methyl]-3-[4-(trifluoromethyl)phenyl]-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine |
| SMILES | CS(=O)(=O)C(C1CO1)N1CCc2[nH]nc(-c3ccc(C(F)(F)F)cc3)c2C1 |
| InChI | InChI=1S/C17H18F3N3O3S/c1-27(24,25)16(14-9-26-14)23-7-6-13-12(8-23)15(22-21-13)10-2-4-11(5-3-10)17(18,19)20/h2-5,14,16H,6-9H2,1H3,(H,21,22) |
| InChIKey | VGOVDICVMAIFGH-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.41 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|