C25H30N6O5 — CID 87207837
2-[3-[[5-amino-1-(3-methylbenzoyl)-1,2,4-triazol-3-yl]amino]phenoxy]-N-[2-(oxan-2-yl)ethoxy]acetamide (PubChem CID 87207837) has the molecular formula C25H30N6O5 and a molecular weight of 494.55 g/mol. Its IUPAC name is 2-[3-[[5-amino-1-(3-methylbenzoyl)-1,2,4-triazol-3-yl]amino]phenoxy]-N-[2-(oxan-2-yl)ethoxy]acetamide.
| Compound Name | 2-[3-[[5-amino-1-(3-methylbenzoyl)-1,2,4-triazol-3-yl]amino]phenoxy]-N-[2-(oxan-2-yl)ethoxy]acetamide |
|---|---|
| PubChem CID | 87207837 |
| Molecular Formula | C25H30N6O5 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | 2-[3-[[5-amino-1-(3-methylbenzoyl)-1,2,4-triazol-3-yl]amino]phenoxy]-N-[2-(oxan-2-yl)ethoxy]acetamide |
| SMILES | Cc1cccc(C(=O)n2nc(Nc3cccc(OCC(=O)NOCCC4CCCCO4)c3)nc2N)c1 |
| InChI | InChI=1S/C25H30N6O5/c1-17-6-4-7-18(14-17)23(33)31-24(26)28-25(29-31)27-19-8-5-10-21(15-19)35-16-22(32)30-36-13-11-20-9-2-3-12-34-20/h4-8,10,14-15,20H,2-3,9,11-13,16H2,1H3,(H,30,32)(H3,26,27,28,29) |
| InChIKey | UHWUEXGZPVTSDY-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 142.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|