About 1,2-dichloro-4-phenylimidazole;dioxolane
1,2-dichloro-4-phenylimidazole;dioxolane (PubChem CID 87208506) has the molecular formula C12H12Cl2N2O2
and a molecular weight of 287.15 g/mol. Its IUPAC name is 1,2-dichloro-4-phenylimidazole;dioxolane.
Molecular Properties
| Compound Name | 1,2-dichloro-4-phenylimidazole;dioxolane |
| PubChem CID | 87208506 |
| Molecular Formula | C12H12Cl2N2O2 |
| Molecular Weight | 287.15 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | 1,2-dichloro-4-phenylimidazole;dioxolane |
| SMILES | C1COOC1.Clc1nc(-c2ccccc2)cn1Cl |
| InChI | InChI=1S/C9H6Cl2N2.C3H6O2/c10-9-12-8(6-13(9)11)7-4-2-1-3-5-7;1-2-4-5-3-1/h1-6H;1-3H2 |
| InChIKey | MYKWSRLLDDEYEV-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.15 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dichloro-4-phenylimidazole;dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dichloro-4-phenylimidazole;dioxolane?
The IUPAC name of 1,2-dichloro-4-phenylimidazole;dioxolane (CID 87208506) is 1,2-dichloro-4-phenylimidazole;dioxolane.
What is the SMILES notation for 1,2-dichloro-4-phenylimidazole;dioxolane?
The canonical SMILES for 1,2-dichloro-4-phenylimidazole;dioxolane is C1COOC1.Clc1nc(-c2ccccc2)cn1Cl.
What is the InChIKey of 1,2-dichloro-4-phenylimidazole;dioxolane?
The InChIKey is MYKWSRLLDDEYEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6Cl2N2.C3H6O2/c10-9-12-8(6-13(9)11)7-4-2-1-3-5-7;1-2-4-5-3-1/h1-6H;1-3H2.
What are the key properties of 1,2-dichloro-4-phenylimidazole;dioxolane?
1,2-dichloro-4-phenylimidazole;dioxolane has a molecular weight of 287.15 g/mol, XLogP of 3.54, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dichloro-4-phenylimidazole;dioxolane is sourced from PubChem (CID 87208506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).