C20H21N3O2S — CID 87208707
N-hydroxy-7,7-dimethyl-5-(quinolin-2-ylmethyl)-4,6-dihydrothieno[3,2-c]pyridine-2-carboxamide (PubChem CID 87208707) has the molecular formula C20H21N3O2S and a molecular weight of 367.47 g/mol. Its IUPAC name is N-hydroxy-7,7-dimethyl-5-(quinolin-2-ylmethyl)-4,6-dihydrothieno[3,2-c]pyridine-2-carboxamide.
| Compound Name | N-hydroxy-7,7-dimethyl-5-(quinolin-2-ylmethyl)-4,6-dihydrothieno[3,2-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 87208707 |
| Molecular Formula | C20H21N3O2S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | N-hydroxy-7,7-dimethyl-5-(quinolin-2-ylmethyl)-4,6-dihydrothieno[3,2-c]pyridine-2-carboxamide |
| SMILES | CC1(C)CN(Cc2ccc3ccccc3n2)Cc2cc(C(=O)NO)sc21 |
| InChI | InChI=1S/C20H21N3O2S/c1-20(2)12-23(10-14-9-17(19(24)22-25)26-18(14)20)11-15-8-7-13-5-3-4-6-16(13)21-15/h3-9,25H,10-12H2,1-2H3,(H,22,24) |
| InChIKey | RUURDMHOXRBFLO-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|