C10H14N2O4S2 — CID 87208727
N-hydroxy-5-propylsulfonyl-4,6-dihydrothieno[2,3-c]pyrrole-2-carboxamide (PubChem CID 87208727) has the molecular formula C10H14N2O4S2 and a molecular weight of 290.37 g/mol. Its IUPAC name is N-hydroxy-5-propylsulfonyl-4,6-dihydrothieno[2,3-c]pyrrole-2-carboxamide.
| Compound Name | N-hydroxy-5-propylsulfonyl-4,6-dihydrothieno[2,3-c]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 87208727 |
| Molecular Formula | C10H14N2O4S2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | N-hydroxy-5-propylsulfonyl-4,6-dihydrothieno[2,3-c]pyrrole-2-carboxamide |
| SMILES | CCCS(=O)(=O)N1Cc2cc(C(=O)NO)sc2C1 |
| InChI | InChI=1S/C10H14N2O4S2/c1-2-3-18(15,16)12-5-7-4-8(10(13)11-14)17-9(7)6-12/h4,14H,2-3,5-6H2,1H3,(H,11,13) |
| InChIKey | NFJMEGSBPPVNOB-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|