C18H14F3N3O2S2 — CID 87208797
N-hydroxy-6-[5-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-2-carboxamide (PubChem CID 87208797) has the molecular formula C18H14F3N3O2S2 and a molecular weight of 425.46 g/mol. Its IUPAC name is N-hydroxy-6-[5-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-2-carboxamide.
| Compound Name | N-hydroxy-6-[5-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 87208797 |
| Molecular Formula | C18H14F3N3O2S2 |
| Molecular Weight | 425.46 g/mol |
| Exact Mass | 425.05 |
| IUPAC Name | N-hydroxy-6-[5-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-2-carboxamide |
| SMILES | O=C(NO)c1cc2c(s1)CN(c1ncc(-c3ccc(C(F)(F)F)cc3)s1)CC2 |
| InChI | InChI=1S/C18H14F3N3O2S2/c19-18(20,21)12-3-1-10(2-4-12)14-8-22-17(28-14)24-6-5-11-7-13(16(25)23-26)27-15(11)9-24/h1-4,7-8,26H,5-6,9H2,(H,23,25) |
| InChIKey | CCEXWPYWROPSMM-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.46 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|