About 1-hexan-2-yloxyethyl acetate
1-hexan-2-yloxyethyl acetate (PubChem CID 87208887) has the molecular formula C10H20O3
and a molecular weight of 188.27 g/mol. Its IUPAC name is 1-hexan-2-yloxyethyl acetate.
Molecular Properties
| Compound Name | 1-hexan-2-yloxyethyl acetate |
| PubChem CID | 87208887 |
| Molecular Formula | C10H20O3 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.14 |
| IUPAC Name | 1-hexan-2-yloxyethyl acetate |
| SMILES | CCCCC(C)OC(C)OC(C)=O |
| InChI | InChI=1S/C10H20O3/c1-5-6-7-8(2)12-10(4)13-9(3)11/h8,10H,5-7H2,1-4H3 |
| InChIKey | GVLSRORHJFVCBQ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-hexan-2-yloxyethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hexan-2-yloxyethyl acetate?
The IUPAC name of 1-hexan-2-yloxyethyl acetate (CID 87208887) is 1-hexan-2-yloxyethyl acetate.
What is the SMILES notation for 1-hexan-2-yloxyethyl acetate?
The canonical SMILES for 1-hexan-2-yloxyethyl acetate is CCCCC(C)OC(C)OC(C)=O.
What is the InChIKey of 1-hexan-2-yloxyethyl acetate?
The InChIKey is GVLSRORHJFVCBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O3/c1-5-6-7-8(2)12-10(4)13-9(3)11/h8,10H,5-7H2,1-4H3.
What are the key properties of 1-hexan-2-yloxyethyl acetate?
1-hexan-2-yloxyethyl acetate has a molecular weight of 188.27 g/mol, XLogP of 2.49, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hexan-2-yloxyethyl acetate is sourced from PubChem (CID 87208887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).