C9H11BrN2OS — CID 87209081
(NE)-N-(2-bromo-5,5-dimethyl-4,6-dihydro-1,3-benzothiazol-7-ylidene)hydroxylamine (PubChem CID 87209081) has the molecular formula C9H11BrN2OS and a molecular weight of 275.17 g/mol. Its IUPAC name is (NE)-N-(2-bromo-5,5-dimethyl-4,6-dihydro-1,3-benzothiazol-7-ylidene)hydroxylamine.
| Compound Name | (NE)-N-(2-bromo-5,5-dimethyl-4,6-dihydro-1,3-benzothiazol-7-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 87209081 |
| Molecular Formula | C9H11BrN2OS |
| Molecular Weight | 275.17 g/mol |
| Exact Mass | 273.98 |
| IUPAC Name | (NE)-N-(2-bromo-5,5-dimethyl-4,6-dihydro-1,3-benzothiazol-7-ylidene)hydroxylamine |
| SMILES | CC1(C)C/C(=N\O)c2sc(Br)nc2C1 |
| InChI | InChI=1S/C9H11BrN2OS/c1-9(2)3-5-7(6(4-9)12-13)14-8(10)11-5/h13H,3-4H2,1-2H3/b12-6+ |
| InChIKey | HUWYABFKYNLUHM-WUXMJOGZSA-N |
| XLogP | 3.06 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.17 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|