About (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) 4-sulfamoylbenzoate
(1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) 4-sulfamoylbenzoate (PubChem CID 87209138) has the molecular formula C11H11N2O7S+
and a molecular weight of 315.28 g/mol. Its IUPAC name is (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) 4-sulfamoylbenzoate.
Molecular Properties
| Compound Name | (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) 4-sulfamoylbenzoate |
| PubChem CID | 87209138 |
| Molecular Formula | C11H11N2O7S+ |
| Molecular Weight | 315.28 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) 4-sulfamoylbenzoate |
| SMILES | NS(=O)(=O)c1ccc(C(=O)O[N+]2(O)C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C11H11N2O7S/c12-21(18,19)8-3-1-7(2-4-8)11(16)20-13(17)9(14)5-6-10(13)15/h1-4,17H,5-6H2,(H2,12,18,19)/q+1 |
| InChIKey | CMBXINHLPCOFDE-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 140.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.28 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) 4-sulfamoylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) 4-sulfamoylbenzoate?
The IUPAC name of (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) 4-sulfamoylbenzoate (CID 87209138) is (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) 4-sulfamoylbenzoate.
What is the SMILES notation for (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) 4-sulfamoylbenzoate?
The canonical SMILES for (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) 4-sulfamoylbenzoate is NS(=O)(=O)c1ccc(C(=O)O[N+]2(O)C(=O)CCC2=O)cc1.
What is the InChIKey of (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) 4-sulfamoylbenzoate?
The InChIKey is CMBXINHLPCOFDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N2O7S/c12-21(18,19)8-3-1-7(2-4-8)11(16)20-13(17)9(14)5-6-10(13)15/h1-4,17H,5-6H2,(H2,12,18,19)/q+1.
What are the key properties of (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) 4-sulfamoylbenzoate?
(1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) 4-sulfamoylbenzoate has a molecular weight of 315.28 g/mol, XLogP of -0.54, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl) 4-sulfamoylbenzoate is sourced from PubChem (CID 87209138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).