C28H35BrCl2N2O3 — CID 87209278
[2-(cyclohexyl-hydroxy-phenylmethyl)-1,3-oxazol-5-yl]methyl-[2-[(3,4-dichlorophenyl)methoxy]ethyl]-dimethylazanium bromide (PubChem CID 87209278) has the molecular formula C28H35BrCl2N2O3 and a molecular weight of 598.41 g/mol. Its IUPAC name is [2-(cyclohexyl-hydroxy-phenylmethyl)-1,3-oxazol-5-yl]methyl-[2-[(3,4-dichlorophenyl)methoxy]ethyl]-dimethylazanium bromide.
| Compound Name | [2-(cyclohexyl-hydroxy-phenylmethyl)-1,3-oxazol-5-yl]methyl-[2-[(3,4-dichlorophenyl)methoxy]ethyl]-dimethylazanium bromide |
|---|---|
| PubChem CID | 87209278 |
| Molecular Formula | C28H35BrCl2N2O3 |
| Molecular Weight | 598.41 g/mol |
| Exact Mass | 596.12 |
| IUPAC Name | [2-(cyclohexyl-hydroxy-phenylmethyl)-1,3-oxazol-5-yl]methyl-[2-[(3,4-dichlorophenyl)methoxy]ethyl]-dimethylazanium bromide |
| SMILES | C[N+](C)(CCOCc1ccc(Cl)c(Cl)c1)Cc1cnc(C(O)(c2ccccc2)C2CCCCC2)o1.[Br-] |
| InChI | InChI=1S/C28H35Cl2N2O3.BrH/c1-32(2,15-16-34-20-21-13-14-25(29)26(30)17-21)19-24-18-31-27(35-24)28(33,22-9-5-3-6-10-22)23-11-7-4-8-12-23;/h3,5-6,9-10,13-14,17-18,23,33H,4,7-8,11-12,15-16,19-20H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | RXPYMUKTZIQPBW-UHFFFAOYSA-M |
| XLogP | 3.59 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.41 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|