C60H78N4O11 — CID 87209302
bis([2-[(R)-cyclohexyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]methyl-dimethyl-(3-phenoxypropyl)azanium);2-hydroxybutanedioate (PubChem CID 87209302) has the molecular formula C60H78N4O11 and a molecular weight of 1031.30 g/mol. Its IUPAC name is bis([2-[(R)-cyclohexyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]methyl-dimethyl-(3-phenoxypropyl)azanium);2-hydroxybutanedioate.
| Compound Name | bis([2-[(R)-cyclohexyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]methyl-dimethyl-(3-phenoxypropyl)azanium);2-hydroxybutanedioate |
|---|---|
| PubChem CID | 87209302 |
| Molecular Formula | C60H78N4O11 |
| Molecular Weight | 1031.30 g/mol |
| Exact Mass | 1030.57 |
| IUPAC Name | bis([2-[(R)-cyclohexyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]methyl-dimethyl-(3-phenoxypropyl)azanium);2-hydroxybutanedioate |
| SMILES | C[N+](C)(CCCOc1ccccc1)Cc1cnc([C@](O)(c2ccccc2)C2CCCCC2)o1.C[N+](C)(CCCOc1ccccc1)Cc1cnc([C@](O)(c2ccccc2)C2CCCCC2)o1.O=C([O-])CC(O)C(=O)[O-] |
| InChI | InChI=1S/2C28H37N2O3.C4H6O5/c2*1-30(2,19-12-20-32-25-17-10-5-11-18-25)22-26-21-29-27(33-26)28(31,23-13-6-3-7-14-23)24-15-8-4-9-16-24;5-2(4(8)9)1-3(6)7/h2*3,5-7,10-11,13-14,17-18,21,24,31H,4,8-9,12,15-16,19-20,22H2,1-2H3;2,5H,1H2,(H,6,7)(H,8,9)/q2*+1;/p-2/t2*28-;/m00./s1 |
| InChIKey | IIXAXWFXXDTYFH-VRRQLQECSA-L |
| XLogP | 7.31 |
| TPSA | 211.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 75 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1031.30 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|