C60H76N4O10 — CID 87209306
(Z)-but-2-enedioate;bis([2-[(R)-cyclohexyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]methyl-dimethyl-(3-phenoxypropyl)azanium) (PubChem CID 87209306) has the molecular formula C60H76N4O10 and a molecular weight of 1013.29 g/mol. Its IUPAC name is (Z)-but-2-enedioate;bis([2-[(R)-cyclohexyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]methyl-dimethyl-(3-phenoxypropyl)azanium).
| Compound Name | (Z)-but-2-enedioate;bis([2-[(R)-cyclohexyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]methyl-dimethyl-(3-phenoxypropyl)azanium) |
|---|---|
| PubChem CID | 87209306 |
| Molecular Formula | C60H76N4O10 |
| Molecular Weight | 1013.29 g/mol |
| Exact Mass | 1012.56 |
| IUPAC Name | (Z)-but-2-enedioate;bis([2-[(R)-cyclohexyl-hydroxy-phenylmethyl]-1,3-oxazol-5-yl]methyl-dimethyl-(3-phenoxypropyl)azanium) |
| SMILES | C[N+](C)(CCCOc1ccccc1)Cc1cnc([C@](O)(c2ccccc2)C2CCCCC2)o1.C[N+](C)(CCCOc1ccccc1)Cc1cnc([C@](O)(c2ccccc2)C2CCCCC2)o1.O=C([O-])/C=C\C(=O)[O-] |
| InChI | InChI=1S/2C28H37N2O3.C4H4O4/c2*1-30(2,19-12-20-32-25-17-10-5-11-18-25)22-26-21-29-27(33-26)28(31,23-13-6-3-7-14-23)24-15-8-4-9-16-24;5-3(6)1-2-4(7)8/h2*3,5-7,10-11,13-14,17-18,21,24,31H,4,8-9,12,15-16,19-20,22H2,1-2H3;1-2H,(H,5,6)(H,7,8)/q2*+1;/p-2/b;;2-1-/t2*28-;/m00./s1 |
| InChIKey | OUWTWQZHKNAKSI-LCAMFTMNSA-L |
| XLogP | 8.11 |
| TPSA | 191.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 74 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1013.29 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|