C12H8Cl2F3NO3 — CID 87209611
(E)-3-(3,5-dichlorophenyl)-2-[[(2,2,2-trifluoroacetyl)amino]methyl]prop-2-enoic acid (PubChem CID 87209611) has the molecular formula C12H8Cl2F3NO3 and a molecular weight of 342.10 g/mol. Its IUPAC name is (E)-3-(3,5-dichlorophenyl)-2-[[(2,2,2-trifluoroacetyl)amino]methyl]prop-2-enoic acid.
| Compound Name | (E)-3-(3,5-dichlorophenyl)-2-[[(2,2,2-trifluoroacetyl)amino]methyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 87209611 |
| Molecular Formula | C12H8Cl2F3NO3 |
| Molecular Weight | 342.10 g/mol |
| Exact Mass | 340.98 |
| IUPAC Name | (E)-3-(3,5-dichlorophenyl)-2-[[(2,2,2-trifluoroacetyl)amino]methyl]prop-2-enoic acid |
| SMILES | O=C(O)/C(=C/c1cc(Cl)cc(Cl)c1)CNC(=O)C(F)(F)F |
| InChI | InChI=1S/C12H8Cl2F3NO3/c13-8-2-6(3-9(14)4-8)1-7(10(19)20)5-18-11(21)12(15,16)17/h1-4H,5H2,(H,18,21)(H,19,20)/b7-1+ |
| InChIKey | WSNYLMWPOZXYET-LREOWRDNSA-N |
| XLogP | 3.14 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.10 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|