About 4-propan-2-ylacridine
4-propan-2-ylacridine (PubChem CID 87209750) has the molecular formula C16H15N
and a molecular weight of 221.30 g/mol. Its IUPAC name is 4-propan-2-ylacridine.
Molecular Properties
| Compound Name | 4-propan-2-ylacridine |
| PubChem CID | 87209750 |
| Molecular Formula | C16H15N |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 4-propan-2-ylacridine |
| SMILES | CC(C)c1cccc2cc3ccccc3nc12 |
| InChI | InChI=1S/C16H15N/c1-11(2)14-8-5-7-13-10-12-6-3-4-9-15(12)17-16(13)14/h3-11H,1-2H3 |
| InChIKey | JIECZTITOZQGIT-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 4-propan-2-ylacridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propan-2-ylacridine?
The IUPAC name of 4-propan-2-ylacridine (CID 87209750) is 4-propan-2-ylacridine.
What is the SMILES notation for 4-propan-2-ylacridine?
The canonical SMILES for 4-propan-2-ylacridine is CC(C)c1cccc2cc3ccccc3nc12.
What is the InChIKey of 4-propan-2-ylacridine?
The InChIKey is JIECZTITOZQGIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N/c1-11(2)14-8-5-7-13-10-12-6-3-4-9-15(12)17-16(13)14/h3-11H,1-2H3.
What are the key properties of 4-propan-2-ylacridine?
4-propan-2-ylacridine has a molecular weight of 221.30 g/mol, XLogP of 4.51, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propan-2-ylacridine is sourced from PubChem (CID 87209750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).