C20H31ClFN7O3 — CID 87210247
[(2R)-2-[[[6-[(9aR)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-2-chloro-5-fluoropyrimidin-4-yl]amino]carbamoyl]hexyl]carbamic acid (PubChem CID 87210247) has the molecular formula C20H31ClFN7O3 and a molecular weight of 471.97 g/mol. Its IUPAC name is [(2R)-2-[[[6-[(9aR)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-2-chloro-5-fluoropyrimidin-4-yl]amino]carbamoyl]hexyl]carbamic acid.
| Compound Name | [(2R)-2-[[[6-[(9aR)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-2-chloro-5-fluoropyrimidin-4-yl]amino]carbamoyl]hexyl]carbamic acid |
|---|---|
| PubChem CID | 87210247 |
| Molecular Formula | C20H31ClFN7O3 |
| Molecular Weight | 471.97 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | [(2R)-2-[[[6-[(9aR)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-2-chloro-5-fluoropyrimidin-4-yl]amino]carbamoyl]hexyl]carbamic acid |
| SMILES | CCCC[C@H](CNC(=O)O)C(=O)NNc1nc(Cl)nc(N2CCN3CCCC[C@@H]3C2)c1F |
| InChI | InChI=1S/C20H31ClFN7O3/c1-2-3-6-13(11-23-20(31)32)18(30)27-26-16-15(22)17(25-19(21)24-16)29-10-9-28-8-5-4-7-14(28)12-29/h13-14,23H,2-12H2,1H3,(H,27,30)(H,31,32)(H,24,25,26)/t13-,14-/m1/s1 |
| InChIKey | FPOPQBZDFRZBBY-ZIAGYGMSSA-N |
| XLogP | 2.46 |
| TPSA | 122.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.97 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|