C13H15NO4 — CID 87210310
5-benzyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-5-ium-5-carboxylate (PubChem CID 87210310) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is 5-benzyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-5-ium-5-carboxylate.
| Compound Name | 5-benzyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-5-ium-5-carboxylate |
|---|---|
| PubChem CID | 87210310 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 5-benzyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-5-ium-5-carboxylate |
| SMILES | O=C([O-])[N+]1(Cc2ccccc2)CC2OCOC2C1 |
| InChI | InChI=1S/C13H15NO4/c15-13(16)14(6-10-4-2-1-3-5-10)7-11-12(8-14)18-9-17-11/h1-5,11-12H,6-9H2 |
| InChIKey | HFGKYIQHZCIMHW-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|