C23H26ClF3N5O3+ — CID 87210348
[4-[2-(3-amino-6-chloro-[1,2,4]triazolo[4,3-b]pyridazin-1-ium-1-yl)acetyl]-2,6-ditert-butylphenyl] 2,2,2-trifluoroacetate (PubChem CID 87210348) has the molecular formula C23H26ClF3N5O3+ and a molecular weight of 512.94 g/mol. Its IUPAC name is [4-[2-(3-amino-6-chloro-[1,2,4]triazolo[4,3-b]pyridazin-1-ium-1-yl)acetyl]-2,6-ditert-butylphenyl] 2,2,2-trifluoroacetate.
| Compound Name | [4-[2-(3-amino-6-chloro-[1,2,4]triazolo[4,3-b]pyridazin-1-ium-1-yl)acetyl]-2,6-ditert-butylphenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87210348 |
| Molecular Formula | C23H26ClF3N5O3+ |
| Molecular Weight | 512.94 g/mol |
| Exact Mass | 512.17 |
| IUPAC Name | [4-[2-(3-amino-6-chloro-[1,2,4]triazolo[4,3-b]pyridazin-1-ium-1-yl)acetyl]-2,6-ditert-butylphenyl] 2,2,2-trifluoroacetate |
| SMILES | CC(C)(C)c1cc(C(=O)C[n+]2nc(N)n3nc(Cl)ccc32)cc(C(C)(C)C)c1OC(=O)C(F)(F)F |
| InChI | InChI=1S/C23H26ClF3N5O3/c1-21(2,3)13-9-12(10-14(22(4,5)6)18(13)35-19(34)23(25,26)27)15(33)11-31-17-8-7-16(24)29-32(17)20(28)30-31/h7-10H,11H2,1-6H3,(H2,28,30)/q+1 |
| InChIKey | ILZIZCJLVGYQOY-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 103.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.94 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|