C22H20ClN3OS2 — CID 87210947
1-(5-methylthiophen-2-yl)-2-[3-[5-[(3-sulfanylidenecyclohexa-1,5-dien-1-yl)methyl]-1H-pyrazol-3-yl]pyridin-1-ium-1-yl]ethanone chloride (PubChem CID 87210947) has the molecular formula C22H20ClN3OS2 and a molecular weight of 442.01 g/mol. Its IUPAC name is 1-(5-methylthiophen-2-yl)-2-[3-[5-[(3-sulfanylidenecyclohexa-1,5-dien-1-yl)methyl]-1H-pyrazol-3-yl]pyridin-1-ium-1-yl]ethanone chloride.
| Compound Name | 1-(5-methylthiophen-2-yl)-2-[3-[5-[(3-sulfanylidenecyclohexa-1,5-dien-1-yl)methyl]-1H-pyrazol-3-yl]pyridin-1-ium-1-yl]ethanone chloride |
|---|---|
| PubChem CID | 87210947 |
| Molecular Formula | C22H20ClN3OS2 |
| Molecular Weight | 442.01 g/mol |
| Exact Mass | 441.07 |
| IUPAC Name | 1-(5-methylthiophen-2-yl)-2-[3-[5-[(3-sulfanylidenecyclohexa-1,5-dien-1-yl)methyl]-1H-pyrazol-3-yl]pyridin-1-ium-1-yl]ethanone chloride |
| SMILES | Cc1ccc(C(=O)C[n+]2cccc(-c3cc(CC4=CC(=S)CC=C4)[nH]n3)c2)s1.[Cl-] |
| InChI | InChI=1S/C22H20N3OS2.ClH/c1-15-7-8-22(28-15)21(26)14-25-9-3-5-17(13-25)20-12-18(23-24-20)10-16-4-2-6-19(27)11-16;/h2-5,7-9,11-13H,6,10,14H2,1H3,(H,23,24);1H/q+1;/p-1 |
| InChIKey | URFXWVRDDFADEQ-UHFFFAOYSA-M |
| XLogP | 1.42 |
| TPSA | 49.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.01 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|