C30H14Cl2F10O2S — CID 87211070
1-[(E)-3-(4-chlorophenyl)-1-[(E)-3-(4-chlorophenyl)-1-(2,3,4,5,6-pentafluorophenyl)prop-2-enyl]sulfonylprop-2-enyl]-2,3,4,5,6-pentafluorobenzene (PubChem CID 87211070) has the molecular formula C30H14Cl2F10O2S and a molecular weight of 699.39 g/mol. Its IUPAC name is 1-[(E)-3-(4-chlorophenyl)-1-[(E)-3-(4-chlorophenyl)-1-(2,3,4,5,6-pentafluorophenyl)prop-2-enyl]sulfonylprop-2-enyl]-2,3,4,5,6-pentafluorobenzene.
| Compound Name | 1-[(E)-3-(4-chlorophenyl)-1-[(E)-3-(4-chlorophenyl)-1-(2,3,4,5,6-pentafluorophenyl)prop-2-enyl]sulfonylprop-2-enyl]-2,3,4,5,6-pentafluorobenzene |
|---|---|
| PubChem CID | 87211070 |
| Molecular Formula | C30H14Cl2F10O2S |
| Molecular Weight | 699.39 g/mol |
| Exact Mass | 697.99 |
| IUPAC Name | 1-[(E)-3-(4-chlorophenyl)-1-[(E)-3-(4-chlorophenyl)-1-(2,3,4,5,6-pentafluorophenyl)prop-2-enyl]sulfonylprop-2-enyl]-2,3,4,5,6-pentafluorobenzene |
| SMILES | O=S(=O)(C(/C=C/c1ccc(Cl)cc1)c1c(F)c(F)c(F)c(F)c1F)C(/C=C/c1ccc(Cl)cc1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C30H14Cl2F10O2S/c31-15-7-1-13(2-8-15)5-11-17(19-21(33)25(37)29(41)26(38)22(19)34)45(43,44)18(12-6-14-3-9-16(32)10-4-14)20-23(35)27(39)30(42)28(40)24(20)36/h1-12,17-18H/b11-5+,12-6+ |
| InChIKey | LBRHQENFVSXKJM-YDWXAUTNSA-N |
| XLogP | 10.01 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.39 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|