C25H52O4Si2 — CID 87211124
(E,4R)-4-methyl-4-triethylsilyloxy-5-[(2R,3R)-3-[(2S,3S)-3-triethylsilyloxypentan-2-yl]oxiran-2-yl]pent-2-en-1-ol (PubChem CID 87211124) has the molecular formula C25H52O4Si2 and a molecular weight of 472.86 g/mol. Its IUPAC name is (E,4R)-4-methyl-4-triethylsilyloxy-5-[(2R,3R)-3-[(2S,3S)-3-triethylsilyloxypentan-2-yl]oxiran-2-yl]pent-2-en-1-ol.
| Compound Name | (E,4R)-4-methyl-4-triethylsilyloxy-5-[(2R,3R)-3-[(2S,3S)-3-triethylsilyloxypentan-2-yl]oxiran-2-yl]pent-2-en-1-ol |
|---|---|
| PubChem CID | 87211124 |
| Molecular Formula | C25H52O4Si2 |
| Molecular Weight | 472.86 g/mol |
| Exact Mass | 472.34 |
| IUPAC Name | (E,4R)-4-methyl-4-triethylsilyloxy-5-[(2R,3R)-3-[(2S,3S)-3-triethylsilyloxypentan-2-yl]oxiran-2-yl]pent-2-en-1-ol |
| SMILES | CC[C@H](O[Si](CC)(CC)CC)[C@@H](C)[C@H]1O[C@@H]1C[C@](C)(/C=C/CO)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C25H52O4Si2/c1-10-22(28-30(11-2,12-3)13-4)21(8)24-23(27-24)20-25(9,18-17-19-26)29-31(14-5,15-6)16-7/h17-18,21-24,26H,10-16,19-20H2,1-9H3/b18-17+/t21-,22+,23-,24-,25+/m1/s1 |
| InChIKey | MYYSCUZFXZQNNY-CAGPUBSFSA-N |
| XLogP | 6.91 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.86 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|