C19H28O6S — CID 87211184
[(2R,3R)-3-[[(2R,3R)-3-[(2R,3S)-3-hydroxypentan-2-yl]oxiran-2-yl]methyl]-3-methyloxiran-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 87211184) has the molecular formula C19H28O6S and a molecular weight of 384.49 g/mol. Its IUPAC name is [(2R,3R)-3-[[(2R,3R)-3-[(2R,3S)-3-hydroxypentan-2-yl]oxiran-2-yl]methyl]-3-methyloxiran-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2R,3R)-3-[[(2R,3R)-3-[(2R,3S)-3-hydroxypentan-2-yl]oxiran-2-yl]methyl]-3-methyloxiran-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87211184 |
| Molecular Formula | C19H28O6S |
| Molecular Weight | 384.49 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | [(2R,3R)-3-[[(2R,3R)-3-[(2R,3S)-3-hydroxypentan-2-yl]oxiran-2-yl]methyl]-3-methyloxiran-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | CC[C@H](O)[C@@H](C)[C@H]1O[C@@H]1C[C@@]1(C)O[C@@H]1COS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H28O6S/c1-5-15(20)13(3)18-16(24-18)10-19(4)17(25-19)11-23-26(21,22)14-8-6-12(2)7-9-14/h6-9,13,15-18,20H,5,10-11H2,1-4H3/t13-,15+,16-,17-,18-,19-/m1/s1 |
| InChIKey | XBUGCSXMRCZSLM-UOBLNPGPSA-N |
| XLogP | 2.42 |
| TPSA | 88.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.49 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|