About 4-sulfanyl-1,2,4-thiadiazolidine-3-thione
4-sulfanyl-1,2,4-thiadiazolidine-3-thione (PubChem CID 87211841) has the molecular formula C2H4N2S3
and a molecular weight of 152.27 g/mol. Its IUPAC name is 4-sulfanyl-1,2,4-thiadiazolidine-3-thione.
Molecular Properties
| Compound Name | 4-sulfanyl-1,2,4-thiadiazolidine-3-thione |
| PubChem CID | 87211841 |
| Molecular Formula | C2H4N2S3 |
| Molecular Weight | 152.27 g/mol |
| Exact Mass | 151.95 |
| IUPAC Name | 4-sulfanyl-1,2,4-thiadiazolidine-3-thione |
| SMILES | S=C1NSCN1S |
| InChI | InChI=1S/C2H4N2S3/c5-2-3-7-1-4(2)6/h6H,1H2,(H,3,5) |
| InChIKey | WFSLYUMPRMWOIM-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.27 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-sulfanyl-1,2,4-thiadiazolidine-3-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-sulfanyl-1,2,4-thiadiazolidine-3-thione?
The IUPAC name of 4-sulfanyl-1,2,4-thiadiazolidine-3-thione (CID 87211841) is 4-sulfanyl-1,2,4-thiadiazolidine-3-thione.
What is the SMILES notation for 4-sulfanyl-1,2,4-thiadiazolidine-3-thione?
The canonical SMILES for 4-sulfanyl-1,2,4-thiadiazolidine-3-thione is S=C1NSCN1S.
What is the InChIKey of 4-sulfanyl-1,2,4-thiadiazolidine-3-thione?
The InChIKey is WFSLYUMPRMWOIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4N2S3/c5-2-3-7-1-4(2)6/h6H,1H2,(H,3,5).
What are the key properties of 4-sulfanyl-1,2,4-thiadiazolidine-3-thione?
4-sulfanyl-1,2,4-thiadiazolidine-3-thione has a molecular weight of 152.27 g/mol, XLogP of 0.63, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-sulfanyl-1,2,4-thiadiazolidine-3-thione is sourced from PubChem (CID 87211841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).