C6H7ClF6 — CID 87212054
4-chloro-2-(difluoromethyl)-1,1,1,2-tetrafluoropentane (PubChem CID 87212054) has the molecular formula C6H7ClF6 and a molecular weight of 228.56 g/mol. Its IUPAC name is 4-chloro-2-(difluoromethyl)-1,1,1,2-tetrafluoropentane.
| Compound Name | 4-chloro-2-(difluoromethyl)-1,1,1,2-tetrafluoropentane |
|---|---|
| PubChem CID | 87212054 |
| Molecular Formula | C6H7ClF6 |
| Molecular Weight | 228.56 g/mol |
| Exact Mass | 228.01 |
| IUPAC Name | 4-chloro-2-(difluoromethyl)-1,1,1,2-tetrafluoropentane |
| SMILES | CC(Cl)CC(F)(C(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H7ClF6/c1-3(7)2-5(10,4(8)9)6(11,12)13/h3-4H,2H2,1H3 |
| InChIKey | CJMKSLNOSZAYQO-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.56 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|