About methyl (2Z)-4,4-difluoro-3-oxo-2-(piperidin-1-ylmethylidene)butanoate
methyl (2Z)-4,4-difluoro-3-oxo-2-(piperidin-1-ylmethylidene)butanoate (PubChem CID 87212958) has the molecular formula C11H15F2NO3
and a molecular weight of 247.24 g/mol. Its IUPAC name is methyl (2Z)-4,4-difluoro-3-oxo-2-(piperidin-1-ylmethylidene)butanoate.
Molecular Properties
| Compound Name | methyl (2Z)-4,4-difluoro-3-oxo-2-(piperidin-1-ylmethylidene)butanoate |
| PubChem CID | 87212958 |
| Molecular Formula | C11H15F2NO3 |
| Molecular Weight | 247.24 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | methyl (2Z)-4,4-difluoro-3-oxo-2-(piperidin-1-ylmethylidene)butanoate |
| SMILES | COC(=O)/C(=C\N1CCCCC1)C(=O)C(F)F |
| InChI | InChI=1S/C11H15F2NO3/c1-17-11(16)8(9(15)10(12)13)7-14-5-3-2-4-6-14/h7,10H,2-6H2,1H3/b8-7- |
| InChIKey | WSHBTMLYJNTBPL-FPLPWBNLSA-N |
| XLogP | 1.36 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.24 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze methyl (2Z)-4,4-difluoro-3-oxo-2-(piperidin-1-ylmethylidene)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2Z)-4,4-difluoro-3-oxo-2-(piperidin-1-ylmethylidene)butanoate?
The IUPAC name of methyl (2Z)-4,4-difluoro-3-oxo-2-(piperidin-1-ylmethylidene)butanoate (CID 87212958) is methyl (2Z)-4,4-difluoro-3-oxo-2-(piperidin-1-ylmethylidene)butanoate.
What is the SMILES notation for methyl (2Z)-4,4-difluoro-3-oxo-2-(piperidin-1-ylmethylidene)butanoate?
The canonical SMILES for methyl (2Z)-4,4-difluoro-3-oxo-2-(piperidin-1-ylmethylidene)butanoate is COC(=O)/C(=C\N1CCCCC1)C(=O)C(F)F.
What is the InChIKey of methyl (2Z)-4,4-difluoro-3-oxo-2-(piperidin-1-ylmethylidene)butanoate?
The InChIKey is WSHBTMLYJNTBPL-FPLPWBNLSA-N. The full InChI is InChI=1S/C11H15F2NO3/c1-17-11(16)8(9(15)10(12)13)7-14-5-3-2-4-6-14/h7,10H,2-6H2,1H3/b8-7-.
What are the key properties of methyl (2Z)-4,4-difluoro-3-oxo-2-(piperidin-1-ylmethylidene)butanoate?
methyl (2Z)-4,4-difluoro-3-oxo-2-(piperidin-1-ylmethylidene)butanoate has a molecular weight of 247.24 g/mol, XLogP of 1.36, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2Z)-4,4-difluoro-3-oxo-2-(piperidin-1-ylmethylidene)butanoate is sourced from PubChem (CID 87212958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).