C9H21ClN2O3 — CID 87213066
2-amino-N-(1,3-dihydroxypropyl)-3,3-dimethylbutanamide;hydrochloride (PubChem CID 87213066) has the molecular formula C9H21ClN2O3 and a molecular weight of 240.73 g/mol. Its IUPAC name is 2-amino-N-(1,3-dihydroxypropyl)-3,3-dimethylbutanamide;hydrochloride.
| Compound Name | 2-amino-N-(1,3-dihydroxypropyl)-3,3-dimethylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 87213066 |
| Molecular Formula | C9H21ClN2O3 |
| Molecular Weight | 240.73 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 2-amino-N-(1,3-dihydroxypropyl)-3,3-dimethylbutanamide;hydrochloride |
| SMILES | CC(C)(C)C(N)C(=O)NC(O)CCO.Cl |
| InChI | InChI=1S/C9H20N2O3.ClH/c1-9(2,3)7(10)8(14)11-6(13)4-5-12;/h6-7,12-13H,4-5,10H2,1-3H3,(H,11,14);1H |
| InChIKey | YUERPCGNNZEWLD-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.73 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|