About 1-oct-7-enyl-3-(2,2,2-trifluoroethyl)imidazol-3-ium
1-oct-7-enyl-3-(2,2,2-trifluoroethyl)imidazol-3-ium (PubChem CID 87213149) has the molecular formula C13H20F3N2+
and a molecular weight of 261.31 g/mol. Its IUPAC name is 1-oct-7-enyl-3-(2,2,2-trifluoroethyl)imidazol-3-ium.
Molecular Properties
| Compound Name | 1-oct-7-enyl-3-(2,2,2-trifluoroethyl)imidazol-3-ium |
| PubChem CID | 87213149 |
| Molecular Formula | C13H20F3N2+ |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | 1-oct-7-enyl-3-(2,2,2-trifluoroethyl)imidazol-3-ium |
| SMILES | C=CCCCCCCn1cc[n+](CC(F)(F)F)c1 |
| InChI | InChI=1S/C13H20F3N2/c1-2-3-4-5-6-7-8-17-9-10-18(12-17)11-13(14,15)16/h2,9-10,12H,1,3-8,11H2/q+1 |
| InChIKey | RFWSBTYZHYJTSC-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-oct-7-enyl-3-(2,2,2-trifluoroethyl)imidazol-3-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-oct-7-enyl-3-(2,2,2-trifluoroethyl)imidazol-3-ium?
The IUPAC name of 1-oct-7-enyl-3-(2,2,2-trifluoroethyl)imidazol-3-ium (CID 87213149) is 1-oct-7-enyl-3-(2,2,2-trifluoroethyl)imidazol-3-ium.
What is the SMILES notation for 1-oct-7-enyl-3-(2,2,2-trifluoroethyl)imidazol-3-ium?
The canonical SMILES for 1-oct-7-enyl-3-(2,2,2-trifluoroethyl)imidazol-3-ium is C=CCCCCCCn1cc[n+](CC(F)(F)F)c1.
What is the InChIKey of 1-oct-7-enyl-3-(2,2,2-trifluoroethyl)imidazol-3-ium?
The InChIKey is RFWSBTYZHYJTSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20F3N2/c1-2-3-4-5-6-7-8-17-9-10-18(12-17)11-13(14,15)16/h2,9-10,12H,1,3-8,11H2/q+1.
What are the key properties of 1-oct-7-enyl-3-(2,2,2-trifluoroethyl)imidazol-3-ium?
1-oct-7-enyl-3-(2,2,2-trifluoroethyl)imidazol-3-ium has a molecular weight of 261.31 g/mol, XLogP of 3.47, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-oct-7-enyl-3-(2,2,2-trifluoroethyl)imidazol-3-ium is sourced from PubChem (CID 87213149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).