C13H25NO6S — CID 87213628
[5-(2,2-dimethylpropanoylamino)-2,2-dimethyl-1,3-dioxan-5-yl]methyl methanesulfonate (PubChem CID 87213628) has the molecular formula C13H25NO6S and a molecular weight of 323.41 g/mol. Its IUPAC name is [5-(2,2-dimethylpropanoylamino)-2,2-dimethyl-1,3-dioxan-5-yl]methyl methanesulfonate.
| Compound Name | [5-(2,2-dimethylpropanoylamino)-2,2-dimethyl-1,3-dioxan-5-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 87213628 |
| Molecular Formula | C13H25NO6S |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | [5-(2,2-dimethylpropanoylamino)-2,2-dimethyl-1,3-dioxan-5-yl]methyl methanesulfonate |
| SMILES | CC1(C)OCC(COS(C)(=O)=O)(NC(=O)C(C)(C)C)CO1 |
| InChI | InChI=1S/C13H25NO6S/c1-11(2,3)10(15)14-13(9-20-21(6,16)17)7-18-12(4,5)19-8-13/h7-9H2,1-6H3,(H,14,15) |
| InChIKey | AYIXIFBDBWFESS-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|